C12H6F3IN4 — CID 66319093
4-[(5-iodopyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 66319093) has the molecular formula C12H6F3IN4 and a molecular weight of 390.11 g/mol. Its IUPAC name is 4-[(5-iodopyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(5-iodopyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 66319093 |
| Molecular Formula | C12H6F3IN4 |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 4-[(5-iodopyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncncc2I)cc1C(F)(F)F |
| InChI | InChI=1S/C12H6F3IN4/c13-12(14,15)9-3-8(2-1-7(9)4-17)20-11-10(16)5-18-6-19-11/h1-3,5-6H,(H,18,19,20) |
| InChIKey | ISAXDEAHCKYQCB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|