C17H20N8O — CID 71036344
1-(2-amino-4-pyridinyl)-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 71036344) has the molecular formula C17H20N8O and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-(2-amino-4-pyridinyl)-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(2-amino-4-pyridinyl)-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 71036344 |
| Molecular Formula | C17H20N8O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-(2-amino-4-pyridinyl)-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1cc(-n2nc(Nc3ccc(N4CCOCC4)cc3)nc2N)ccn1 |
| InChI | InChI=1S/C17H20N8O/c18-15-11-14(5-6-20-15)25-16(19)22-17(23-25)21-12-1-3-13(4-2-12)24-7-9-26-10-8-24/h1-6,11H,7-10H2,(H2,18,20)(H3,19,21,22,23) |
| InChIKey | CZGWVSKNGVDUPJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|