C16H19N9 — CID 58976203
3-N-(4-piperazin-1-ylphenyl)-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine (PubChem CID 58976203) has the molecular formula C16H19N9 and a molecular weight of 337.39 g/mol. Its IUPAC name is 3-N-(4-piperazin-1-ylphenyl)-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(4-piperazin-1-ylphenyl)-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976203 |
| Molecular Formula | C16H19N9 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-N-(4-piperazin-1-ylphenyl)-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCNCC3)cc2)nn1-c1ccncn1 |
| InChI | InChI=1S/C16H19N9/c17-15-22-16(23-25(15)14-5-6-19-11-20-14)21-12-1-3-13(4-2-12)24-9-7-18-8-10-24/h1-6,11,18H,7-10H2,(H3,17,21,22,23) |
| InChIKey | PNHODHDUIUTKNH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|