C21H28N10O — CID 58976675
1-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58976675) has the molecular formula C21H28N10O and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976675 |
| Molecular Formula | C21H28N10O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CCN(c2nccc(-n3nc(Nc4ccc(N5CCOCC5)cc4)nc3N)n2)CC1 |
| InChI | InChI=1S/C21H28N10O/c1-28-8-10-30(11-9-28)21-23-7-6-18(25-21)31-19(22)26-20(27-31)24-16-2-4-17(5-3-16)29-12-14-32-15-13-29/h2-7H,8-15H2,1H3,(H3,22,24,26,27) |
| InChIKey | MJPXKPAHBIIKGB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|