C26H29N9 — CID 25127405
1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 25127405) has the molecular formula C26H29N9 and a molecular weight of 467.58 g/mol. Its IUPAC name is 1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 25127405 |
| Molecular Formula | C26H29N9 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CCN(c2ccc(Nc3nc(N)n(-c4cc5c(nn4)-c4ccccc4CCC5)n3)cc2)CC1 |
| InChI | InChI=1S/C26H29N9/c1-33-13-15-34(16-14-33)21-11-9-20(10-12-21)28-26-29-25(27)35(32-26)23-17-19-7-4-6-18-5-2-3-8-22(18)24(19)31-30-23/h2-3,5,8-12,17H,4,6-7,13-16H2,1H3,(H3,27,28,29,32) |
| InChIKey | LXBUXLGQCKDMLW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|