C29H32N8 — CID 67104046
3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 67104046) has the molecular formula C29H32N8 and a molecular weight of 492.63 g/mol. Its IUPAC name is 3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 67104046 |
| Molecular Formula | C29H32N8 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc3c(c2)CN(C2CCCC2)CC3)nn1-c1cc2c(nn1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C29H32N8/c30-28-32-29(31-23-13-12-19-14-15-36(18-22(19)16-23)24-9-2-3-10-24)35-37(28)26-17-21-8-5-7-20-6-1-4-11-25(20)27(21)34-33-26/h1,4,6,11-13,16-17,24H,2-3,5,7-10,14-15,18H2,(H3,30,31,32,35) |
| InChIKey | CRPQHUZTWKECLW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |