C19H26N6 — CID 112884090
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112884090) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112884090 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | CN1CCN(c2ccc(Nc3ccnc(N4CCCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C19H26N6/c1-23-12-14-24(15-13-23)17-6-4-16(5-7-17)21-18-8-9-20-19(22-18)25-10-2-3-11-25/h4-9H,2-3,10-15H2,1H3,(H,20,21,22) |
| InChIKey | QEVJPHQDMYRQJM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|