C22H31N5 — CID 112901130
2-(3-methylpiperidin-1-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidin-4-amine (PubChem CID 112901130) has the molecular formula C22H31N5 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 2-(3-methylpiperidin-1-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112901130 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidin-4-amine |
| SMILES | CC1CCN(c2ccc(Nc3ccnc(N4CCCC(C)C4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H31N5/c1-17-10-14-26(15-11-17)20-7-5-19(6-8-20)24-21-9-12-23-22(25-21)27-13-3-4-18(2)16-27/h5-9,12,17-18H,3-4,10-11,13-16H2,1-2H3,(H,23,24,25) |
| InChIKey | RAHAZPVXVFZANH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|