C23H27N5O — CID 112904779
2-N-(4-methoxyphenyl)-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 112904779) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-methoxyphenyl)-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112904779 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nccc(Nc3ccc(N4CCC(C)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H27N5O/c1-17-12-15-28(16-13-17)20-7-3-18(4-8-20)25-22-11-14-24-23(27-22)26-19-5-9-21(29-2)10-6-19/h3-11,14,17H,12-13,15-16H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | DYHUKQCJKPSMGF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|