C20H23ClN8 — CID 159568006
4-N-(2-chloropyrimidin-4-yl)-2-N-[4-[4-(methylamino)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine (PubChem CID 159568006) has the molecular formula C20H23ClN8 and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-N-(2-chloropyrimidin-4-yl)-2-N-[4-[4-(methylamino)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-chloropyrimidin-4-yl)-2-N-[4-[4-(methylamino)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 159568006 |
| Molecular Formula | C20H23ClN8 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-N-(2-chloropyrimidin-4-yl)-2-N-[4-[4-(methylamino)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine |
| SMILES | CNC1CCN(c2ccc(Nc3nccc(Nc4ccnc(Cl)n4)n3)cc2)CC1 |
| InChI | InChI=1S/C20H23ClN8/c1-22-14-8-12-29(13-9-14)16-4-2-15(3-5-16)25-20-24-11-7-18(28-20)26-17-6-10-23-19(21)27-17/h2-7,10-11,14,22H,8-9,12-13H2,1H3,(H2,23,24,25,26,27,28) |
| InChIKey | MHLHERNWTQQNED-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|