C24H27N9O2 — CID 58976897
1-[2-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58976897) has the molecular formula C24H27N9O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-[2-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[2-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976897 |
| Molecular Formula | C24H27N9O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-[2-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | COc1ccc(CNc2nccc(-n3nc(Nc4ccc(N5CCOCC5)cc4)nc3N)n2)cc1 |
| InChI | InChI=1S/C24H27N9O2/c1-34-20-8-2-17(3-9-20)16-27-23-26-11-10-21(29-23)33-22(25)30-24(31-33)28-18-4-6-19(7-5-18)32-12-14-35-15-13-32/h2-11H,12-16H2,1H3,(H,26,27,29)(H3,25,28,30,31) |
| InChIKey | PCDIKEKEJMXEAL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|