C23H23Cl2N9O — CID 58976410
1-[6-[(2,5-dichlorophenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58976410) has the molecular formula C23H23Cl2N9O and a molecular weight of 512.41 g/mol. Its IUPAC name is 1-[6-[(2,5-dichlorophenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[6-[(2,5-dichlorophenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976410 |
| Molecular Formula | C23H23Cl2N9O |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 1-[6-[(2,5-dichlorophenyl)methylamino]pyrimidin-4-yl]-3-N-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCOCC3)cc2)nn1-c1cc(NCc2cc(Cl)ccc2Cl)ncn1 |
| InChI | InChI=1S/C23H23Cl2N9O/c24-16-1-6-19(25)15(11-16)13-27-20-12-21(29-14-28-20)34-22(26)31-23(32-34)30-17-2-4-18(5-3-17)33-7-9-35-10-8-33/h1-6,11-12,14H,7-10,13H2,(H,27,28,29)(H3,26,30,31,32) |
| InChIKey | ULBYIFHRAKTZIF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|