C21H19N5O2 — CID 58975976
1-(4-methoxyphenyl)-3-N-(4-phenoxyphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58975976) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-N-(4-phenoxyphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(4-methoxyphenyl)-3-N-(4-phenoxyphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58975976 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-N-(4-phenoxyphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | COc1ccc(-n2nc(Nc3ccc(Oc4ccccc4)cc3)nc2N)cc1 |
| InChI | InChI=1S/C21H19N5O2/c1-27-17-13-9-16(10-14-17)26-20(22)24-21(25-26)23-15-7-11-19(12-8-15)28-18-5-3-2-4-6-18/h2-14H,1H3,(H3,22,23,24,25) |
| InChIKey | HREFETOABNWQBP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |