C11H15N5O — CID 114797790
3-N-ethyl-1-(3-methoxyphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 114797790) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 3-N-ethyl-1-(3-methoxyphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-ethyl-1-(3-methoxyphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 114797790 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-N-ethyl-1-(3-methoxyphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | CCNc1nc(N)n(-c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C11H15N5O/c1-3-13-11-14-10(12)16(15-11)8-5-4-6-9(7-8)17-2/h4-7H,3H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | KXWCUFPHKIJMQT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |