C13H17N5O2 — CID 114797795
2-(3-methoxyphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine (PubChem CID 114797795) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine.
| Compound Name | 2-(3-methoxyphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 114797795 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(3-methoxyphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(-n2nc(N3CCOCC3)nc2N)c1 |
| InChI | InChI=1S/C13H17N5O2/c1-19-11-4-2-3-10(9-11)18-12(14)15-13(16-18)17-5-7-20-8-6-17/h2-4,9H,5-8H2,1H3,(H2,14,15,16) |
| InChIKey | RPSSRSFZENHYAC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |