C13H16BrN5O — CID 104508479
2-(4-bromo-2-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine (PubChem CID 104508479) has the molecular formula C13H16BrN5O and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine.
| Compound Name | 2-(4-bromo-2-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104508479 |
| Molecular Formula | C13H16BrN5O |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(Br)ccc1-n1nc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C13H16BrN5O/c1-9-8-10(14)2-3-11(9)19-12(15)16-13(17-19)18-4-6-20-7-5-18/h2-3,8H,4-7H2,1H3,(H2,15,16,17) |
| InChIKey | XIXLBNKMICMGQQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |