C29H38N8O3 — CID 10076145
4-[4,6-bis[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]morpholine (PubChem CID 10076145) has the molecular formula C29H38N8O3 and a molecular weight of 546.68 g/mol. Its IUPAC name is 4-[4,6-bis[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4,6-bis[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 10076145 |
| Molecular Formula | C29H38N8O3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 4-[4,6-bis[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]morpholine |
| SMILES | COc1ccc(N2CCN(c3nc(N4CCOCC4)nc(N4CCN(c5ccc(OC)cc5)CC4)n3)CC2)cc1 |
| InChI | InChI=1S/C29H38N8O3/c1-38-25-7-3-23(4-8-25)33-11-15-35(16-12-33)27-30-28(32-29(31-27)37-19-21-40-22-20-37)36-17-13-34(14-18-36)24-5-9-26(39-2)10-6-24/h3-10H,11-22H2,1-2H3 |
| InChIKey | CLXLGFKIDLTYKE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|