C22H35N7O — CID 4296013
2-N,2-N,4-N,4-N-tetraethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 4296013) has the molecular formula C22H35N7O and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetraethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetraethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 4296013 |
| Molecular Formula | C22H35N7O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetraethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N(CC)CC)nc(N2CCN(c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C22H35N7O/c1-6-26(7-2)20-23-21(27(8-3)9-4)25-22(24-20)29-16-14-28(15-17-29)18-10-12-19(30-5)13-11-18/h10-13H,6-9,14-17H2,1-5H3 |
| InChIKey | XGLYNYUVGQBPBI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|