C21H31N5O — CID 112925591
N-butyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N,6-dimethylpyrimidin-4-amine (PubChem CID 112925591) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is N-butyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N,6-dimethylpyrimidin-4-amine.
| Compound Name | N-butyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112925591 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-butyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N,6-dimethylpyrimidin-4-amine |
| SMILES | CCCCN(C)c1cc(C)nc(N2CCN(c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C21H31N5O/c1-5-6-11-24(3)20-16-17(2)22-21(23-20)26-14-12-25(13-15-26)18-7-9-19(27-4)10-8-18/h7-10,16H,5-6,11-15H2,1-4H3 |
| InChIKey | MXBHVRJWVDEGQF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|