C15H15N5O — CID 58976009
1-(3-methoxyphenyl)-3-N-phenyl-1,2,4-triazole-3,5-diamine (PubChem CID 58976009) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-N-phenyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(3-methoxyphenyl)-3-N-phenyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976009 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-N-phenyl-1,2,4-triazole-3,5-diamine |
| SMILES | COc1cccc(-n2nc(Nc3ccccc3)nc2N)c1 |
| InChI | InChI=1S/C15H15N5O/c1-21-13-9-5-8-12(10-13)20-14(16)18-15(19-20)17-11-6-3-2-4-7-11/h2-10H,1H3,(H3,16,17,18,19) |
| InChIKey | WUPSPKBAEWRTCL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |