C22H25N9 — CID 58976761
1-(6-anilinopyrimidin-4-yl)-3-N-[4-(diethylamino)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 58976761) has the molecular formula C22H25N9 and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-(6-anilinopyrimidin-4-yl)-3-N-[4-(diethylamino)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(6-anilinopyrimidin-4-yl)-3-N-[4-(diethylamino)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976761 |
| Molecular Formula | C22H25N9 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-(6-anilinopyrimidin-4-yl)-3-N-[4-(diethylamino)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(N)n(-c3cc(Nc4ccccc4)ncn3)n2)cc1 |
| InChI | InChI=1S/C22H25N9/c1-3-30(4-2)18-12-10-17(11-13-18)27-22-28-21(23)31(29-22)20-14-19(24-15-25-20)26-16-8-6-5-7-9-16/h5-15H,3-4H2,1-2H3,(H,24,25,26)(H3,23,27,28,29) |
| InChIKey | JJGGZIQVCONWQK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|