C19H24N6O2S — CID 58976584
3-N-[4-(diethylamino)phenyl]-1-(4-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58976584) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is 3-N-[4-(diethylamino)phenyl]-1-(4-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-(diethylamino)phenyl]-1-(4-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976584 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-N-[4-(diethylamino)phenyl]-1-(4-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(N)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C19H24N6O2S/c1-4-24(5-2)15-8-6-14(7-9-15)21-19-22-18(20)25(23-19)16-10-12-17(13-11-16)28(3,26)27/h6-13H,4-5H2,1-3H3,(H3,20,21,22,23) |
| InChIKey | SFZZFPIKUHUYEQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|