C18H22N8 — CID 58976376
1-(6-anilinopyrimidin-4-yl)-3-N-cyclohexyl-1,2,4-triazole-3,5-diamine (PubChem CID 58976376) has the molecular formula C18H22N8 and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-(6-anilinopyrimidin-4-yl)-3-N-cyclohexyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(6-anilinopyrimidin-4-yl)-3-N-cyclohexyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976376 |
| Molecular Formula | C18H22N8 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-(6-anilinopyrimidin-4-yl)-3-N-cyclohexyl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NC2CCCCC2)nn1-c1cc(Nc2ccccc2)ncn1 |
| InChI | InChI=1S/C18H22N8/c19-17-24-18(23-14-9-5-2-6-10-14)25-26(17)16-11-15(20-12-21-16)22-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,20,21,22)(H3,19,23,24,25) |
| InChIKey | MTMWBQJMFPLOEE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |