C21H25N5 — CID 112865025
6-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112865025) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 6-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112865025 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 6-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(CC)c1ccc(Nc2cc(N(C)c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C21H25N5/c1-4-26(5-2)19-13-11-17(12-14-19)24-20-15-21(23-16-22-20)25(3)18-9-7-6-8-10-18/h6-16H,4-5H2,1-3H3,(H,22,23,24) |
| InChIKey | HFKNLNWFPBPFEN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|