C19H20N4 — CID 112864985
6-N-(4-ethylphenyl)-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112864985) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 6-N-(4-ethylphenyl)-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-ethylphenyl)-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864985 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 6-N-(4-ethylphenyl)-4-N-methyl-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCc1ccc(Nc2cc(N(C)c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C19H20N4/c1-3-15-9-11-16(12-10-15)22-18-13-19(21-14-20-18)23(2)17-7-5-4-6-8-17/h4-14H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | KMJUHNYDJOCITQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |