C18H20N6O — CID 117076740
4-(3-aminopyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine (PubChem CID 117076740) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-(3-aminopyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine.
| Compound Name | 4-(3-aminopyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 117076740 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-(3-aminopyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
| SMILES | Nc1ccn(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)n1 |
| InChI | InChI=1S/C18H20N6O/c19-17-6-8-24(22-17)16-5-7-20-18(13-16)21-14-1-3-15(4-2-14)23-9-11-25-12-10-23/h1-8,13H,9-12H2,(H2,19,22)(H,20,21) |
| InChIKey | BNPCOFGUGBDMNO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|