C21H23N5O — CID 117087554
2-(3-aminophenyl)-6-methyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine (PubChem CID 117087554) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-(3-aminophenyl)-6-methyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine.
| Compound Name | 2-(3-aminophenyl)-6-methyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 117087554 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-(3-aminophenyl)-6-methyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(N3CCOCC3)cc2)nc(-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C21H23N5O/c1-15-13-20(25-21(23-15)16-3-2-4-17(22)14-16)24-18-5-7-19(8-6-18)26-9-11-27-12-10-26/h2-8,13-14H,9-12,22H2,1H3,(H,23,24,25) |
| InChIKey | VWMMELZDSVOXNI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|