C21H20F3N5 — CID 112878918
2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112878918) has the molecular formula C21H20F3N5 and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112878918 |
| Molecular Formula | C21H20F3N5 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2ccc(N3CCCC3)cc2)cc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C21H20F3N5/c1-13-25-18(27-14-4-6-15(7-5-14)29-10-2-3-11-29)12-19(26-13)28-17-9-8-16(22)20(23)21(17)24/h4-9,12H,2-3,10-11H2,1H3,(H2,25,26,27,28) |
| InChIKey | JWYWWGWVXXVWPQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|