C18H25N5S — CID 91223873
2-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,3-thiazole-2,4-diamine (PubChem CID 91223873) has the molecular formula C18H25N5S and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 91223873 |
| Molecular Formula | C18H25N5S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(Nc2ccc(N3CCC(N4CCCC4)CC3)cc2)n1 |
| InChI | InChI=1S/C18H25N5S/c19-17-13-24-18(21-17)20-14-3-5-15(6-4-14)23-11-7-16(8-12-23)22-9-1-2-10-22/h3-6,13,16H,1-2,7-12,19H2,(H,20,21) |
| InChIKey | FBYOPSWTFFUDRD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|