C26H31N5O2S — CID 11503889
[4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-hydroxyphenyl)methanone (PubChem CID 11503889) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-hydroxyphenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 11503889 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-hydroxyphenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCCC4)CC3)cc2)sc1C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C26H31N5O2S/c27-25-24(23(33)18-5-4-6-22(32)17-18)34-26(29-25)28-19-7-9-20(10-8-19)31-15-11-21(12-16-31)30-13-2-1-3-14-30/h4-10,17,21,32H,1-3,11-16,27H2,(H,28,29) |
| InChIKey | ZTFVYDSOPXVBLP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|