C27H34N6O4S — CID 163581728
2-[3-[4-amino-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]-1,3-thiazole-5-carbonyl]phenyl]-N-hydroxyethanamine oxide (PubChem CID 163581728) has the molecular formula C27H34N6O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is 2-[3-[4-amino-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]-1,3-thiazole-5-carbonyl]phenyl]-N-hydroxyethanamine oxide.
| Compound Name | 2-[3-[4-amino-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]-1,3-thiazole-5-carbonyl]phenyl]-N-hydroxyethanamine oxide |
|---|---|
| PubChem CID | 163581728 |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 2-[3-[4-amino-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]-1,3-thiazole-5-carbonyl]phenyl]-N-hydroxyethanamine oxide |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCOCC4)CC3)cc2)sc1C(=O)c1cccc(CC[NH+]([O-])O)c1 |
| InChI | InChI=1S/C27H34N6O4S/c28-26-25(24(34)20-3-1-2-19(18-20)8-13-33(35)36)38-27(30-26)29-21-4-6-22(7-5-21)31-11-9-23(10-12-31)32-14-16-37-17-15-32/h1-7,18,23,33,35H,8-17,28H2,(H,29,30) |
| InChIKey | GICSMZQUZKOXNN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|