C26H29N5O3S — CID 10206739
[4-amino-2-[4-(4-cyclopentylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 10206739) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is [4-amino-2-[4-(4-cyclopentylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [4-amino-2-[4-(4-cyclopentylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 10206739 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | [4-amino-2-[4-(4-cyclopentylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCN(C4CCCC4)CC3)cc2)sc1C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H29N5O3S/c27-25-24(23(32)17-5-10-21-22(15-17)34-16-33-21)35-26(29-25)28-18-6-8-20(9-7-18)31-13-11-30(12-14-31)19-3-1-2-4-19/h5-10,15,19H,1-4,11-14,16,27H2,(H,28,29) |
| InChIKey | HVRXPPYRRYVKTN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|