C22H24N4O4S — CID 22641046
[4-amino-2-[4-[2-(propan-2-ylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 22641046) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is [4-amino-2-[4-[2-(propan-2-ylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [4-amino-2-[4-[2-(propan-2-ylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 22641046 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | [4-amino-2-[4-[2-(propan-2-ylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | CC(C)NCCOc1ccc(Nc2nc(N)c(C(=O)c3ccc4c(c3)OCO4)s2)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c1-13(2)24-9-10-28-16-6-4-15(5-7-16)25-22-26-21(23)20(31-22)19(27)14-3-8-17-18(11-14)30-12-29-17/h3-8,11,13,24H,9-10,12,23H2,1-2H3,(H,25,26) |
| InChIKey | NQPQUPQZPPEOOZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|