C21H24N4O2S — CID 10321833
[4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone (PubChem CID 10321833) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is [4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone.
| Compound Name | [4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 10321833 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone |
| SMILES | CCNCCOc1ccc(Nc2nc(N)c(C(=O)c3cccc(C)c3)s2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-3-23-11-12-27-17-9-7-16(8-10-17)24-21-25-20(22)19(28-21)18(26)15-6-4-5-14(2)13-15/h4-10,13,23H,3,11-12,22H2,1-2H3,(H,24,25) |
| InChIKey | ILLRWIKJFIACSP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|