C23H26N4O2S — CID 10345170
[4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-cyclopropylphenyl)methanone (PubChem CID 10345170) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is [4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-cyclopropylphenyl)methanone.
| Compound Name | [4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-cyclopropylphenyl)methanone |
|---|---|
| PubChem CID | 10345170 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [4-amino-2-[4-[2-(ethylamino)ethoxy]anilino]-1,3-thiazol-5-yl]-(3-cyclopropylphenyl)methanone |
| SMILES | CCNCCOc1ccc(Nc2nc(N)c(C(=O)c3cccc(C4CC4)c3)s2)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-2-25-12-13-29-19-10-8-18(9-11-19)26-23-27-22(24)21(30-23)20(28)17-5-3-4-16(14-17)15-6-7-15/h3-5,8-11,14-15,25H,2,6-7,12-13,24H2,1H3,(H,26,27) |
| InChIKey | CIMCWUAUKUSXMB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|