C26H35N7O2S — CID 142154082
[4-amino-2-[4-(4-hydroxypiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-amino-4-pyrrolidin-1-ylphenyl)methanone;ethane (PubChem CID 142154082) has the molecular formula C26H35N7O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is [4-amino-2-[4-(4-hydroxypiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-amino-4-pyrrolidin-1-ylphenyl)methanone;ethane.
| Compound Name | [4-amino-2-[4-(4-hydroxypiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-amino-4-pyrrolidin-1-ylphenyl)methanone;ethane |
|---|---|
| PubChem CID | 142154082 |
| Molecular Formula | C26H35N7O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | [4-amino-2-[4-(4-hydroxypiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-amino-4-pyrrolidin-1-ylphenyl)methanone;ethane |
| SMILES | CC.Nc1cc(C(=O)c2sc(Nc3ccc(N4CCN(O)CC4)cc3)nc2N)ccc1N1CCCC1 |
| InChI | InChI=1S/C24H29N7O2S.C2H6/c25-19-15-16(3-8-20(19)30-9-1-2-10-30)21(32)22-23(26)28-24(34-22)27-17-4-6-18(7-5-17)29-11-13-31(33)14-12-29;1-2/h3-8,15,33H,1-2,9-14,25-26H2,(H,27,28);1-2H3 |
| InChIKey | KWNCUOODXPPCQZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|