C23H25Cl2N5OS — CID 11691671
[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-dichlorophenyl)methanone (PubChem CID 11691671) has the molecular formula C23H25Cl2N5OS and a molecular weight of 490.46 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 11691671 |
| Molecular Formula | C23H25Cl2N5OS |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-dichlorophenyl)methanone |
| SMILES | CN(C)C1CCN(c2ccc(Nc3nc(N)c(C(=O)c4ccc(Cl)c(Cl)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C23H25Cl2N5OS/c1-29(2)16-9-11-30(12-10-16)17-6-4-15(5-7-17)27-23-28-22(26)21(32-23)20(31)14-3-8-18(24)19(25)13-14/h3-8,13,16H,9-12,26H2,1-2H3,(H,27,28) |
| InChIKey | JMINICXTEUCDMC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|