C27H31N5O4S — CID 11511961
4-[4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzoic acid (PubChem CID 11511961) has the molecular formula C27H31N5O4S and a molecular weight of 521.64 g/mol. Its IUPAC name is 4-[4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzoic acid.
| Compound Name | 4-[4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 11511961 |
| Molecular Formula | C27H31N5O4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 4-[4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzoic acid |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCC(O)C4)CC3)cc2)sc1C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H31N5O4S/c28-25-24(23(34)17-3-5-18(6-4-17)26(35)36)37-27(30-25)29-19-7-9-20(10-8-19)31-14-11-21(12-15-31)32-13-1-2-22(33)16-32/h3-10,21-22,33H,1-2,11-16,28H2,(H,29,30)(H,35,36) |
| InChIKey | HUSVNOGLAUMHPS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|