C24H28FN5O2S — CID 10116068
[4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 10116068) has the molecular formula C24H28FN5O2S and a molecular weight of 469.59 g/mol. Its IUPAC name is [4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 10116068 |
| Molecular Formula | C24H28FN5O2S |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2sc(Nc3ccc(N4CCN(C(C)C)CC4)cc3)nc2N)cc1F |
| InChI | InChI=1S/C24H28FN5O2S/c1-15(2)29-10-12-30(13-11-29)18-7-5-17(6-8-18)27-24-28-23(26)22(33-24)21(31)16-4-9-20(32-3)19(25)14-16/h4-9,14-15H,10-13,26H2,1-3H3,(H,27,28) |
| InChIKey | RYVQSOBBDPMAKP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|