C25H31F2N5O2S — CID 142154080
[4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluoro-4-methoxyphenyl)methanone;propane (PubChem CID 142154080) has the molecular formula C25H31F2N5O2S and a molecular weight of 503.62 g/mol. Its IUPAC name is [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluoro-4-methoxyphenyl)methanone;propane.
| Compound Name | [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluoro-4-methoxyphenyl)methanone;propane |
|---|---|
| PubChem CID | 142154080 |
| Molecular Formula | C25H31F2N5O2S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluoro-4-methoxyphenyl)methanone;propane |
| SMILES | CCC.COc1c(F)cc(C(=O)c2sc(Nc3ccc(N4CCN(C)CC4)cc3)nc2N)cc1F |
| InChI | InChI=1S/C22H23F2N5O2S.C3H8/c1-28-7-9-29(10-8-28)15-5-3-14(4-6-15)26-22-27-21(25)20(32-22)18(30)13-11-16(23)19(31-2)17(24)12-13;1-3-2/h3-6,11-12H,7-10,25H2,1-2H3,(H,26,27);3H2,1-2H3 |
| InChIKey | YAZINWRPIJCKMY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|