C26H35FN5O2PS — CID 142154047
[4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluoro-5-phosphanylphenyl)methanone;propane (PubChem CID 142154047) has the molecular formula C26H35FN5O2PS and a molecular weight of 531.64 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluoro-5-phosphanylphenyl)methanone;propane.
| Compound Name | [4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluoro-5-phosphanylphenyl)methanone;propane |
|---|---|
| PubChem CID | 142154047 |
| Molecular Formula | C26H35FN5O2PS |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | [4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluoro-5-phosphanylphenyl)methanone;propane |
| SMILES | CCC.COCCN1CCN(c2ccc(Nc3nc(N)c(C(=O)c4cc(F)cc(P)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C23H27FN5O2PS.C3H8/c1-31-11-10-28-6-8-29(9-7-28)18-4-2-17(3-5-18)26-23-27-22(25)21(33-23)20(30)15-12-16(24)14-19(32)13-15;1-3-2/h2-5,12-14H,6-11,25,32H2,1H3,(H,26,27);3H2,1-2H3 |
| InChIKey | XRFLVJZXZJXZSC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|