C22H23F2N5OS — CID 54108717
[4-amino-2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone (PubChem CID 54108717) has the molecular formula C22H23F2N5OS and a molecular weight of 443.52 g/mol. Its IUPAC name is [4-amino-2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 54108717 |
| Molecular Formula | C22H23F2N5OS |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [4-amino-2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone |
| SMILES | C[C@@H]1CN(c2ccc(Nc3nc(N)c(C(=O)c4c(F)cccc4F)s3)cc2)CCN1C |
| InChI | InChI=1S/C22H23F2N5OS/c1-13-12-29(11-10-28(13)2)15-8-6-14(7-9-15)26-22-27-21(25)20(31-22)19(30)18-16(23)4-3-5-17(18)24/h3-9,13H,10-12,25H2,1-2H3,(H,26,27)/t13-/m1/s1 |
| InChIKey | NFONZSKSXJKFSV-CYBMUJFWSA-N |
| XLogP | 4.12 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|