C22H24FN5O2S — CID 10275076
[4-amino-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone (PubChem CID 10275076) has the molecular formula C22H24FN5O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 10275076 |
| Molecular Formula | C22H24FN5O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [4-amino-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCN(CCO)CC3)cc2)sc1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H24FN5O2S/c23-16-3-1-2-15(14-16)19(30)20-21(24)26-22(31-20)25-17-4-6-18(7-5-17)28-10-8-27(9-11-28)12-13-29/h1-7,14,29H,8-13,24H2,(H,25,26) |
| InChIKey | RHJSWMCEBJDQBC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|