C21H21BrN4O2S — CID 18521816
[4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(2-bromo-6-methylphenyl)methanone (PubChem CID 18521816) has the molecular formula C21H21BrN4O2S and a molecular weight of 473.40 g/mol. Its IUPAC name is [4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(2-bromo-6-methylphenyl)methanone.
| Compound Name | [4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(2-bromo-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 18521816 |
| Molecular Formula | C21H21BrN4O2S |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | [4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(2-bromo-6-methylphenyl)methanone |
| SMILES | Cc1cccc(Br)c1C(=O)c1sc(Nc2ccc(N3CCOCC3)cc2)nc1N |
| InChI | InChI=1S/C21H21BrN4O2S/c1-13-3-2-4-16(22)17(13)18(27)19-20(23)25-21(29-19)24-14-5-7-15(8-6-14)26-9-11-28-12-10-26/h2-8H,9-12,23H2,1H3,(H,24,25) |
| InChIKey | YCSKWRZRSQMKPN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|