C19H22N6O2S — CID 18521922
[4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(1,5-dimethylimidazol-4-yl)methanone (PubChem CID 18521922) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is [4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(1,5-dimethylimidazol-4-yl)methanone.
| Compound Name | [4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(1,5-dimethylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 18521922 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [4-amino-2-(4-morpholin-4-ylanilino)-1,3-thiazol-5-yl]-(1,5-dimethylimidazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)c2sc(Nc3ccc(N4CCOCC4)cc3)nc2N)ncn1C |
| InChI | InChI=1S/C19H22N6O2S/c1-12-15(21-11-24(12)2)16(26)17-18(20)23-19(28-17)22-13-3-5-14(6-4-13)25-7-9-27-10-8-25/h3-6,11H,7-10,20H2,1-2H3,(H,22,23) |
| InChIKey | FHICZMOCSXZQIE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|