C30H34N6OS — CID 157059197
1-[3-[4-amino-2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]propan-1-one (PubChem CID 157059197) has the molecular formula C30H34N6OS and a molecular weight of 526.71 g/mol. Its IUPAC name is 1-[3-[4-amino-2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]propan-1-one.
| Compound Name | 1-[3-[4-amino-2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 157059197 |
| Molecular Formula | C30H34N6OS |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 1-[3-[4-amino-2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]propan-1-one |
| SMILES | CCC(=O)c1cccc(-c2csc3c(N)nc(Nc4ccc(N5CCC(N6CCCC6)CC5)cc4)nc23)c1 |
| InChI | InChI=1S/C30H34N6OS/c1-2-26(37)21-7-5-6-20(18-21)25-19-38-28-27(25)33-30(34-29(28)31)32-22-8-10-23(11-9-22)36-16-12-24(13-17-36)35-14-3-4-15-35/h5-11,18-19,24H,2-4,12-17H2,1H3,(H3,31,32,33,34) |
| InChIKey | ABCUUTYBQQZZBF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|