C27H23ClN6O4S — CID 53238654
N-[3-[4-amino-2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-chloropyridine-4-carboxamide (PubChem CID 53238654) has the molecular formula C27H23ClN6O4S and a molecular weight of 563.04 g/mol. Its IUPAC name is N-[3-[4-amino-2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-chloropyridine-4-carboxamide.
| Compound Name | N-[3-[4-amino-2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 53238654 |
| Molecular Formula | C27H23ClN6O4S |
| Molecular Weight | 563.04 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | N-[3-[4-amino-2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-chloropyridine-4-carboxamide |
| SMILES | COc1cc(Nc2nc(N)c3scc(-c4cccc(NC(=O)c5ccnc(Cl)c5)c4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H23ClN6O4S/c1-36-19-11-17(12-20(37-2)23(19)38-3)32-27-33-22-18(13-39-24(22)25(29)34-27)14-5-4-6-16(9-14)31-26(35)15-7-8-30-21(28)10-15/h4-13H,1-3H3,(H,31,35)(H3,29,32,33,34) |
| InChIKey | FYKGGHYBTNXHGB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.04 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|