C28H31N7OS — CID 59491477
2-cyano-N-[4-[2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]sulfanylphenyl]acetamide (PubChem CID 59491477) has the molecular formula C28H31N7OS and a molecular weight of 513.67 g/mol. Its IUPAC name is 2-cyano-N-[4-[2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]sulfanylphenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 59491477 |
| Molecular Formula | C28H31N7OS |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-cyano-N-[4-[2-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]sulfanylphenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(Sc2ccnc(Nc3ccc(N4CCC(N5CCCC5)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C28H31N7OS/c29-15-11-26(36)31-21-5-9-25(10-6-21)37-27-12-16-30-28(33-27)32-22-3-7-23(8-4-22)35-19-13-24(14-20-35)34-17-1-2-18-34/h3-10,12,16,24H,1-2,11,13-14,17-20H2,(H,31,36)(H,30,32,33) |
| InChIKey | WSYZQQYATJXZCT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|