C24H24N6O2S — CID 59491631
2-cyano-N-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]acetamide (PubChem CID 59491631) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-cyano-N-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]acetamide.
| Compound Name | 2-cyano-N-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 59491631 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-cyano-N-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]acetamide |
| SMILES | N#CCC(=O)NCc1ccc(Sc2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H24N6O2S/c25-11-9-22(31)27-17-18-1-7-21(8-2-18)33-23-10-12-26-24(29-23)28-19-3-5-20(6-4-19)30-13-15-32-16-14-30/h1-8,10,12H,9,13-17H2,(H,27,31)(H,26,28,29) |
| InChIKey | NXMCPFRKAZNPSK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|