C25H24N8OS — CID 59491738
5-amino-3-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]imidazole-4-carbonitrile (PubChem CID 59491738) has the molecular formula C25H24N8OS and a molecular weight of 484.59 g/mol. Its IUPAC name is 5-amino-3-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]imidazole-4-carbonitrile.
| Compound Name | 5-amino-3-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 59491738 |
| Molecular Formula | C25H24N8OS |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 5-amino-3-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]methyl]imidazole-4-carbonitrile |
| SMILES | N#Cc1c(N)ncn1Cc1ccc(Sc2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H24N8OS/c26-15-22-24(27)29-17-33(22)16-18-1-7-21(8-2-18)35-23-9-10-28-25(31-23)30-19-3-5-20(6-4-19)32-11-13-34-14-12-32/h1-10,17H,11-14,16,27H2,(H,28,30,31) |
| InChIKey | BSQCVRKNUASENX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|